cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate

C14H14N2O3 — CID 132551637

IUPACcyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate
SMILESO=C(OC1CCCC1)c1nnc(-c2ccccc2)o1
InChIInChI=1S/C14H14N2O3/c17-14(18-11-8-4-5-9-11)13-16-15-12(19-13)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2
InChIKeyYRSBCOLPYMNJDU-UHFFFAOYSA-N
MW258.28 g/mol
LogP2.84
Rot. Bonds3

About cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate

cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 132551637) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namecyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate
PubChem CID132551637
Molecular FormulaC14H14N2O3
Molecular Weight258.28 g/mol
Exact Mass258.10
IUPAC Namecyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate
SMILESO=C(OC1CCCC1)c1nnc(-c2ccccc2)o1
InChIInChI=1S/C14H14N2O3/c17-14(18-11-8-4-5-9-11)13-16-15-12(19-13)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2
InChIKeyYRSBCOLPYMNJDU-UHFFFAOYSA-N
XLogP2.84
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate (CID 132551637) is cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate is O=C(OC1CCCC1)c1nnc(-c2ccccc2)o1.
What is the InChIKey of cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is YRSBCOLPYMNJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c17-14(18-11-8-4-5-9-11)13-16-15-12(19-13)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2.
What are the key properties of cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate?
cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 258.28 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 132551637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).