C25H27NO3 — CID 54365561
cyclooctyl 2-(4-methyl-5-phenyl-1,3-oxazol-2-yl)benzoate (PubChem CID 54365561) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is cyclooctyl 2-(4-methyl-5-phenyl-1,3-oxazol-2-yl)benzoate.
| Compound Name | cyclooctyl 2-(4-methyl-5-phenyl-1,3-oxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 54365561 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | cyclooctyl 2-(4-methyl-5-phenyl-1,3-oxazol-2-yl)benzoate |
| SMILES | Cc1nc(-c2ccccc2C(=O)OC2CCCCCCC2)oc1-c1ccccc1 |
| InChI | InChI=1S/C25H27NO3/c1-18-23(19-12-6-5-7-13-19)29-24(26-18)21-16-10-11-17-22(21)25(27)28-20-14-8-3-2-4-9-15-20/h5-7,10-13,16-17,20H,2-4,8-9,14-15H2,1H3 |
| InChIKey | UPNIJGSQOAENCV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |