C16H12N2O2 — CID 2461697
2-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanone (PubChem CID 2461697) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanone.
| Compound Name | 2-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 2461697 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanone |
| SMILES | O=C(Cc1ccccc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H12N2O2/c19-14(11-12-7-3-1-4-8-12)16-18-17-15(20-16)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | MZXWMROYJCJJIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |