C17H15N3O2 — CID 110390946
N-ethyl-N,5-diphenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110390946) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-ethyl-N,5-diphenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-ethyl-N,5-diphenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110390946 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-ethyl-N,5-diphenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CCN(C(=O)c1nnc(-c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O2/c1-2-20(14-11-7-4-8-12-14)17(21)16-19-18-15(22-16)13-9-5-3-6-10-13/h3-12H,2H2,1H3 |
| InChIKey | XKSUOJUVCLMSCP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |