C15H17N3O3 — CID 23586812
N-[1-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide (PubChem CID 23586812) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[1-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide.
| Compound Name | N-[1-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide |
|---|---|
| PubChem CID | 23586812 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[1-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide |
| SMILES | CCCCC(NC=O)C(=O)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H17N3O3/c1-2-3-9-12(16-10-19)13(20)15-18-17-14(21-15)11-7-5-4-6-8-11/h4-8,10,12H,2-3,9H2,1H3,(H,16,19) |
| InChIKey | BOHOSUGVBLFVMB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|