C14H16N4O3 — CID 23586795
N-[1-oxo-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide (PubChem CID 23586795) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-[1-oxo-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide.
| Compound Name | N-[1-oxo-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide |
|---|---|
| PubChem CID | 23586795 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[1-oxo-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)hexan-2-yl]formamide |
| SMILES | CCCCC(NC=O)C(=O)c1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C14H16N4O3/c1-2-3-6-10(16-9-19)12(20)14-18-17-13(21-14)11-7-4-5-8-15-11/h4-5,7-10H,2-3,6H2,1H3,(H,16,19) |
| InChIKey | ZBIXUKXVAUCJPT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|