C13H15N3O3 — CID 59027826
methyl 5-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentanoate (PubChem CID 59027826) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 5-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentanoate.
| Compound Name | methyl 5-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentanoate |
|---|---|
| PubChem CID | 59027826 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methyl 5-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentanoate |
| SMILES | COC(=O)CCCCc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C13H15N3O3/c1-18-12(17)8-3-2-7-11-15-16-13(19-11)10-6-4-5-9-14-10/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | HLPLFRJHZAUVIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|