C13H15BN2O5 — CID 58343901
[4-[5-(4-methoxy-4-oxobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid (PubChem CID 58343901) has the molecular formula C13H15BN2O5 and a molecular weight of 290.08 g/mol. Its IUPAC name is [4-[5-(4-methoxy-4-oxobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid.
| Compound Name | [4-[5-(4-methoxy-4-oxobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 58343901 |
| Molecular Formula | C13H15BN2O5 |
| Molecular Weight | 290.08 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [4-[5-(4-methoxy-4-oxobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
| SMILES | COC(=O)CCCc1nnc(-c2ccc(B(O)O)cc2)o1 |
| InChI | InChI=1S/C13H15BN2O5/c1-20-12(17)4-2-3-11-15-16-13(21-11)9-5-7-10(8-6-9)14(18)19/h5-8,18-19H,2-4H2,1H3 |
| InChIKey | WKNFREYZOJKCPR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.08 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|