C18H15ClN2O3 — CID 134049813
(4-chlorophenyl) 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate (PubChem CID 134049813) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is (4-chlorophenyl) 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate.
| Compound Name | (4-chlorophenyl) 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate |
|---|---|
| PubChem CID | 134049813 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (4-chlorophenyl) 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate |
| SMILES | Cc1ccc(-c2nnc(CCC(=O)Oc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C18H15ClN2O3/c1-12-2-4-13(5-3-12)18-21-20-16(24-18)10-11-17(22)23-15-8-6-14(19)7-9-15/h2-9H,10-11H2,1H3 |
| InChIKey | ZYIUXAMIRFLAPZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|