C20H19NO3 — CID 30136027
(4-methylphenyl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 30136027) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (4-methylphenyl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (4-methylphenyl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 30136027 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (4-methylphenyl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | Cc1ccc(OC(=O)CCc2ncc(-c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-14-3-7-16(8-4-14)18-13-21-19(24-18)11-12-20(22)23-17-9-5-15(2)6-10-17/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | VHPVRBRCSRERRN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|