C24H21NO4 — CID 134011939
(7-methoxynaphthalen-2-yl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 134011939) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (7-methoxynaphthalen-2-yl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 134011939 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | COc1ccc2ccc(OC(=O)CCc3ncc(-c4ccc(C)cc4)o3)cc2c1 |
| InChI | InChI=1S/C24H21NO4/c1-16-3-5-18(6-4-16)22-15-25-23(29-22)11-12-24(26)28-21-10-8-17-7-9-20(27-2)13-19(17)14-21/h3-10,13-15H,11-12H2,1-2H3 |
| InChIKey | UERASMAUWMBPHE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|