C25H29N3O3 — CID 86867799
3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 86867799) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 86867799 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | COc1ccc(-c2cnc(CCC(=O)N3CCCN(c4ccc(C)cc4)CC3)o2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-19-4-8-21(9-5-19)27-14-3-15-28(17-16-27)25(29)13-12-24-26-18-23(31-24)20-6-10-22(30-2)11-7-20/h4-11,18H,3,12-17H2,1-2H3 |
| InChIKey | JPLXEOBXKDCOCG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|