C23H17F2NO4 — CID 46690882
(7-methoxynaphthalen-2-yl) 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 46690882) has the molecular formula C23H17F2NO4 and a molecular weight of 409.39 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (7-methoxynaphthalen-2-yl) 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 46690882 |
| Molecular Formula | C23H17F2NO4 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | COc1ccc2ccc(OC(=O)CCc3ncc(-c4c(F)cccc4F)o3)cc2c1 |
| InChI | InChI=1S/C23H17F2NO4/c1-28-16-7-5-14-6-8-17(12-15(14)11-16)29-22(27)10-9-21-26-13-20(30-21)23-18(24)3-2-4-19(23)25/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | MKVZNSOJXRIYLM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|