C20H16N2O5 — CID 36808276
(7-methoxynaphthalen-2-yl) 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 36808276) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | (7-methoxynaphthalen-2-yl) 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 36808276 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | COc1ccc2ccc(OC(=O)CCc3nc(-c4ccco4)no3)cc2c1 |
| InChI | InChI=1S/C20H16N2O5/c1-24-15-6-4-13-5-7-16(12-14(13)11-15)26-19(23)9-8-18-21-20(22-27-18)17-3-2-10-25-17/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | YQOYTPHXECCBMM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|