C12H10BF5N2O3 — CID 44518801
[4-[5-(3,3,4,4,4-pentafluorobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid (PubChem CID 44518801) has the molecular formula C12H10BF5N2O3 and a molecular weight of 336.03 g/mol. Its IUPAC name is [4-[5-(3,3,4,4,4-pentafluorobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid.
| Compound Name | [4-[5-(3,3,4,4,4-pentafluorobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 44518801 |
| Molecular Formula | C12H10BF5N2O3 |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [4-[5-(3,3,4,4,4-pentafluorobutyl)-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2nnc(CCC(F)(F)C(F)(F)F)o2)cc1 |
| InChI | InChI=1S/C12H10BF5N2O3/c14-11(15,12(16,17)18)6-5-9-19-20-10(23-9)7-1-3-8(4-2-7)13(21)22/h1-4,21-22H,5-6H2 |
| InChIKey | WNXCUEHUKXHPRI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|