C11H11N3O3 — CID 54929432
4-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 54929432) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)butanoic acid.
| Compound Name | 4-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 54929432 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nnc(-c2ccncc2)o1 |
| InChI | InChI=1S/C11H11N3O3/c15-10(16)3-1-2-9-13-14-11(17-9)8-4-6-12-7-5-8/h4-7H,1-3H2,(H,15,16) |
| InChIKey | YETCXWRAIGSUQT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |