C10H10N2O4 — CID 60906941
4-[5-(furan-3-yl)-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 60906941) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-[5-(furan-3-yl)-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 4-[5-(furan-3-yl)-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 60906941 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-[5-(furan-3-yl)-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nnc(-c2ccoc2)o1 |
| InChI | InChI=1S/C10H10N2O4/c13-9(14)3-1-2-8-11-12-10(16-8)7-4-5-15-6-7/h4-6H,1-3H2,(H,13,14) |
| InChIKey | QBSZIUGXGNXAMD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |