C14H16BN3O4 — CID 58343692
[4-[5-[2-(2-oxopyrrolidin-1-yl)ethyl]-1,3,4-oxadiazol-2-yl]phenyl]boronic acid (PubChem CID 58343692) has the molecular formula C14H16BN3O4 and a molecular weight of 301.11 g/mol. Its IUPAC name is [4-[5-[2-(2-oxopyrrolidin-1-yl)ethyl]-1,3,4-oxadiazol-2-yl]phenyl]boronic acid.
| Compound Name | [4-[5-[2-(2-oxopyrrolidin-1-yl)ethyl]-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 58343692 |
| Molecular Formula | C14H16BN3O4 |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [4-[5-[2-(2-oxopyrrolidin-1-yl)ethyl]-1,3,4-oxadiazol-2-yl]phenyl]boronic acid |
| SMILES | O=C1CCCN1CCc1nnc(-c2ccc(B(O)O)cc2)o1 |
| InChI | InChI=1S/C14H16BN3O4/c19-13-2-1-8-18(13)9-7-12-16-17-14(22-12)10-3-5-11(6-4-10)15(20)21/h3-6,20-21H,1-2,7-9H2 |
| InChIKey | JSQJLLYYGKUXQT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|