C18H23N5O5S — CID 53131924
5-[4-(dimethylsulfamoyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 53131924) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 5-[4-(dimethylsulfamoyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[4-(dimethylsulfamoyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 53131924 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 5-[4-(dimethylsulfamoyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2nnc(C(=O)NCCCN3CCCC3=O)o2)cc1 |
| InChI | InChI=1S/C18H23N5O5S/c1-22(2)29(26,27)14-8-6-13(7-9-14)17-20-21-18(28-17)16(25)19-10-4-12-23-11-3-5-15(23)24/h6-9H,3-5,10-12H2,1-2H3,(H,19,25) |
| InChIKey | OXVMCUWPYPAGKW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|