C16H20N5O4+ — CID 8005234
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-[3-(2-oxopyrrolidin-1-yl)propyl]azanium (PubChem CID 8005234) has the molecular formula C16H20N5O4+ and a molecular weight of 346.37 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-[3-(2-oxopyrrolidin-1-yl)propyl]azanium.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-[3-(2-oxopyrrolidin-1-yl)propyl]azanium |
|---|---|
| PubChem CID | 8005234 |
| Molecular Formula | C16H20N5O4+ |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-[3-(2-oxopyrrolidin-1-yl)propyl]azanium |
| SMILES | O=C1CCCN1CCC[NH2+]Cc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H19N5O4/c22-15-3-1-9-20(15)10-2-8-17-11-14-18-19-16(25-14)12-4-6-13(7-5-12)21(23)24/h4-7,17H,1-3,8-11H2/p+1 |
| InChIKey | ZMQUWJFNXGRJPW-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|