C16H17N3O3 — CID 17035023
1-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 17035023) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17035023 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(-c2nnc(CCCN3C(=O)CCC3=O)o2)cc1 |
| InChI | InChI=1S/C16H17N3O3/c1-11-4-6-12(7-5-11)16-18-17-13(22-16)3-2-10-19-14(20)8-9-15(19)21/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | YHTIKQKKUPEVQU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|