C18H26N2O — CID 102384865
2-(4-methylphenyl)-5-nonyl-1,3,4-oxadiazole (PubChem CID 102384865) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-nonyl-1,3,4-oxadiazole.
| Compound Name | 2-(4-methylphenyl)-5-nonyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102384865 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-(4-methylphenyl)-5-nonyl-1,3,4-oxadiazole |
| SMILES | CCCCCCCCCc1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C18H26N2O/c1-3-4-5-6-7-8-9-10-17-19-20-18(21-17)16-13-11-15(2)12-14-16/h11-14H,3-10H2,1-2H3 |
| InChIKey | NSTVEOHAYKFUHO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|