C34H42N8O2 — CID 10651109
2-(4-octylphenyl)-5-[6-[5-(4-octylphenyl)-1,3,4-oxadiazol-2-yl]-1,2,4,5-tetrazin-3-yl]-1,3,4-oxadiazole (PubChem CID 10651109) has the molecular formula C34H42N8O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is 2-(4-octylphenyl)-5-[6-[5-(4-octylphenyl)-1,3,4-oxadiazol-2-yl]-1,2,4,5-tetrazin-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-octylphenyl)-5-[6-[5-(4-octylphenyl)-1,3,4-oxadiazol-2-yl]-1,2,4,5-tetrazin-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 10651109 |
| Molecular Formula | C34H42N8O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 2-(4-octylphenyl)-5-[6-[5-(4-octylphenyl)-1,3,4-oxadiazol-2-yl]-1,2,4,5-tetrazin-3-yl]-1,3,4-oxadiazole |
| SMILES | CCCCCCCCc1ccc(-c2nnc(-c3nnc(-c4nnc(-c5ccc(CCCCCCCC)cc5)o4)nn3)o2)cc1 |
| InChI | InChI=1S/C34H42N8O2/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)31-39-41-33(43-31)29-35-37-30(38-36-29)34-42-40-32(44-34)28-23-19-26(20-24-28)16-14-12-10-8-6-4-2/h17-24H,3-16H2,1-2H3 |
| InChIKey | YJCPXKHMSJGCKR-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 129.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|