C30H32N2O — CID 23522269
2-[3-(4-ethenylphenyl)phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole (PubChem CID 23522269) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-[3-(4-ethenylphenyl)phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-(4-ethenylphenyl)phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 23522269 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[3-(4-ethenylphenyl)phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole |
| SMILES | C=Cc1ccc(-c2cccc(-c3nnc(-c4ccc(CCCCCCCC)cc4)o3)c2)cc1 |
| InChI | InChI=1S/C30H32N2O/c1-3-5-6-7-8-9-11-24-16-20-26(21-17-24)29-31-32-30(33-29)28-13-10-12-27(22-28)25-18-14-23(4-2)15-19-25/h4,10,12-22H,2-3,5-9,11H2,1H3 |
| InChIKey | ICLGQEUHVJZPRA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|