C36H44N2O4 — CID 70992285
2-[4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]phenyl]-5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazole (PubChem CID 70992285) has the molecular formula C36H44N2O4 and a molecular weight of 568.76 g/mol. Its IUPAC name is 2-[4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]phenyl]-5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]phenyl]-5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70992285 |
| Molecular Formula | C36H44N2O4 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | 2-[4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]phenyl]-5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCc1ccc(-c2ccc(-c3nnc(-c4ccc(OCCCCCCOCC5(C)COC5)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C36H44N2O4/c1-3-4-7-10-28-11-13-29(14-12-28)30-15-17-31(18-16-30)34-37-38-35(42-34)32-19-21-33(22-20-32)41-24-9-6-5-8-23-39-25-36(2)26-40-27-36/h11-22H,3-10,23-27H2,1-2H3 |
| InChIKey | RMLOYASTCBAXRO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|