C9H15ClN2O — CID 114770895
2-chloro-5-heptyl-1,3,4-oxadiazole (PubChem CID 114770895) has the molecular formula C9H15ClN2O and a molecular weight of 202.68 g/mol. Its IUPAC name is 2-chloro-5-heptyl-1,3,4-oxadiazole.
| Compound Name | 2-chloro-5-heptyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114770895 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-chloro-5-heptyl-1,3,4-oxadiazole |
| SMILES | CCCCCCCc1nnc(Cl)o1 |
| InChI | InChI=1S/C9H15ClN2O/c1-2-3-4-5-6-7-8-11-12-9(10)13-8/h2-7H2,1H3 |
| InChIKey | AAHISCPZYBOQDO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|