C11H21N3O — CID 65428930
(5-octyl-1,3,4-oxadiazol-2-yl)methanamine (PubChem CID 65428930) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (5-octyl-1,3,4-oxadiazol-2-yl)methanamine.
| Compound Name | (5-octyl-1,3,4-oxadiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 65428930 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (5-octyl-1,3,4-oxadiazol-2-yl)methanamine |
| SMILES | CCCCCCCCc1nnc(CN)o1 |
| InChI | InChI=1S/C11H21N3O/c1-2-3-4-5-6-7-8-10-13-14-11(9-12)15-10/h2-9,12H2,1H3 |
| InChIKey | YAALPGDWFGNHRP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|