C12H21ClN2O — CID 65448540
2-(1-chloroethyl)-5-octyl-1,3,4-oxadiazole (PubChem CID 65448540) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-octyl-1,3,4-oxadiazole.
| Compound Name | 2-(1-chloroethyl)-5-octyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 65448540 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-(1-chloroethyl)-5-octyl-1,3,4-oxadiazole |
| SMILES | CCCCCCCCc1nnc(C(C)Cl)o1 |
| InChI | InChI=1S/C12H21ClN2O/c1-3-4-5-6-7-8-9-11-14-15-12(16-11)10(2)13/h10H,3-9H2,1-2H3 |
| InChIKey | RPQFYQSFKQXOGZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|