C16H31N3O — CID 65427378
1-(5-octyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine (PubChem CID 65427378) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-(5-octyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(5-octyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 65427378 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 1-(5-octyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCCCCCCc1nnc(C(CC)NCCC)o1 |
| InChI | InChI=1S/C16H31N3O/c1-4-7-8-9-10-11-12-15-18-19-16(20-15)14(6-3)17-13-5-2/h14,17H,4-13H2,1-3H3 |
| InChIKey | TZTFWYILMHAFKZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|