About N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine
N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine (PubChem CID 62162889) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine |
| PubChem CID | 62162889 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCCCCCc1nnc(C(C)NCCC)o1 |
| InChI | InChI=1S/C14H27N3O/c1-4-6-7-8-9-10-13-16-17-14(18-13)12(3)15-11-5-2/h12,15H,4-11H2,1-3H3 |
| InChIKey | LXFBUYQSELAWJG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine?
The IUPAC name of N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine (CID 62162889) is N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine.
What is the SMILES notation for N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine?
The canonical SMILES for N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine is CCCCCCCc1nnc(C(C)NCCC)o1.
What is the InChIKey of N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine?
The InChIKey is LXFBUYQSELAWJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-4-6-7-8-9-10-13-16-17-14(18-13)12(3)15-11-5-2/h12,15H,4-11H2,1-3H3.
What are the key properties of N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine?
N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine has a molecular weight of 253.39 g/mol, XLogP of 3.64, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-heptyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine is sourced from PubChem (CID 62162889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).