C7H11ClN2O2 — CID 114771018
2-chloro-5-(3-ethoxypropyl)-1,3,4-oxadiazole (PubChem CID 114771018) has the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 2-chloro-5-(3-ethoxypropyl)-1,3,4-oxadiazole.
| Compound Name | 2-chloro-5-(3-ethoxypropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771018 |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-chloro-5-(3-ethoxypropyl)-1,3,4-oxadiazole |
| SMILES | CCOCCCc1nnc(Cl)o1 |
| InChI | InChI=1S/C7H11ClN2O2/c1-2-11-5-3-4-6-9-10-7(8)12-6/h2-5H2,1H3 |
| InChIKey | SJZFKXQDZFMSJO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|