C14H18N4O2 — CID 110330217
N-butyl-3-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)propanamide (PubChem CID 110330217) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-butyl-3-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)propanamide.
| Compound Name | N-butyl-3-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 110330217 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-butyl-3-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)propanamide |
| SMILES | CCCCNC(=O)CCc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C14H18N4O2/c1-2-3-9-16-12(19)7-8-13-17-18-14(20-13)11-6-4-5-10-15-11/h4-6,10H,2-3,7-9H2,1H3,(H,16,19) |
| InChIKey | VIYMANAQAVBLHA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|