C19H26ClN3O2 — CID 18859405
3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-octylpropanamide (PubChem CID 18859405) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-octylpropanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-octylpropanamide |
|---|---|
| PubChem CID | 18859405 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-octylpropanamide |
| SMILES | CCCCCCCCNC(=O)CCc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-2-3-4-5-6-9-14-21-17(24)12-13-18-22-23-19(25-18)15-10-7-8-11-16(15)20/h7-8,10-11H,2-6,9,12-14H2,1H3,(H,21,24) |
| InChIKey | RPIGCHREEAOFCP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|