C14H16ClN3O2 — CID 110391277
5-(2-chlorophenyl)-N-pentyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110391277) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-pentyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-pentyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110391277 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 5-(2-chlorophenyl)-N-pentyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CCCCCNC(=O)c1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-2-3-6-9-16-12(19)14-18-17-13(20-14)10-7-4-5-8-11(10)15/h4-5,7-8H,2-3,6,9H2,1H3,(H,16,19) |
| InChIKey | AVAMVSWWLLFXNF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|