C13H14ClN3O2 — CID 110391269
5-(2-chlorophenyl)-N,N-diethyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110391269) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N,N-diethyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N,N-diethyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110391269 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(2-chlorophenyl)-N,N-diethyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-3-17(4-2)13(18)12-16-15-11(19-12)9-7-5-6-8-10(9)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | KGMAMQOGXHWRRU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |