C18H14ClN3O4 — CID 110391348
ethyl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]amino]benzoate (PubChem CID 110391348) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is ethyl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 110391348 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | ethyl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-2-25-18(24)12-8-4-6-10-14(12)20-15(23)17-22-21-16(26-17)11-7-3-5-9-13(11)19/h3-10H,2H2,1H3,(H,20,23) |
| InChIKey | IVVCEDRHPISCKV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |