C16H21N3O2 — CID 110393441
N-pentyl-5-(2-phenylethyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110393441) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-pentyl-5-(2-phenylethyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-pentyl-5-(2-phenylethyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110393441 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-pentyl-5-(2-phenylethyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CCCCCNC(=O)c1nnc(CCc2ccccc2)o1 |
| InChI | InChI=1S/C16H21N3O2/c1-2-3-7-12-17-15(20)16-19-18-14(21-16)11-10-13-8-5-4-6-9-13/h4-6,8-9H,2-3,7,10-12H2,1H3,(H,17,20) |
| InChIKey | FOJCJZJEEXCUJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|