C15H18ClN3O3 — CID 110334461
3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 110334461) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 110334461 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CCc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H18ClN3O3/c1-21-10-4-9-17-13(20)7-8-14-18-19-15(22-14)11-5-2-3-6-12(11)16/h2-3,5-6H,4,7-10H2,1H3,(H,17,20) |
| InChIKey | DCWLUXYQMHWASD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|