C15H17ClN2O3 — CID 78759935
[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl hexanoate (PubChem CID 78759935) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl hexanoate.
| Compound Name | [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 78759935 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-2-3-4-9-14(19)20-10-13-17-18-15(21-13)11-7-5-6-8-12(11)16/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | KXLWOIGUBXWNGT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|