C13H13ClN2O3 — CID 78761992
[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl butanoate (PubChem CID 78761992) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl butanoate.
| Compound Name | [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 78761992 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OCc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-2-5-12(17)18-8-11-15-16-13(19-11)9-6-3-4-7-10(9)14/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | LZYHUAUWVZUPDY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |