About propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate
propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate (PubChem CID 78825656) has the molecular formula C17H22ClN3O3
and a molecular weight of 351.83 g/mol. Its IUPAC name is propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate |
| PubChem CID | 78825656 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC(C)C)Cc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-4-9-21(11-16(22)23-12(2)3)10-15-19-20-17(24-15)13-7-5-6-8-14(13)18/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | BPHWZTDSIGUCNA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate?
The IUPAC name of propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate (CID 78825656) is propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate.
What is the SMILES notation for propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate?
The canonical SMILES for propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate is CCCN(CC(=O)OC(C)C)Cc1nnc(-c2ccccc2Cl)o1.
What is the InChIKey of propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate?
The InChIKey is BPHWZTDSIGUCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O3/c1-4-9-21(11-16(22)23-12(2)3)10-15-19-20-17(24-15)13-7-5-6-8-14(13)18/h5-8,12H,4,9-11H2,1-3H3.
What are the key properties of propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate?
propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate has a molecular weight of 351.83 g/mol, XLogP of 3.55, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]acetate is sourced from PubChem (CID 78825656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).