C21H22ClN5O4 — CID 78825285
2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 78825285) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 78825285 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1cccc([N+](=O)[O-])c1C)Cc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C21H22ClN5O4/c1-3-11-26(12-19(28)23-17-9-6-10-18(14(17)2)27(29)30)13-20-24-25-21(31-20)15-7-4-5-8-16(15)22/h4-10H,3,11-13H2,1-2H3,(H,23,28) |
| InChIKey | UBPPJASAJCQYNP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|