C19H18ClN5O4 — CID 27165148
1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3-nitrophenyl)-1-propylurea (PubChem CID 27165148) has the molecular formula C19H18ClN5O4 and a molecular weight of 415.84 g/mol. Its IUPAC name is 1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3-nitrophenyl)-1-propylurea.
| Compound Name | 1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3-nitrophenyl)-1-propylurea |
|---|---|
| PubChem CID | 27165148 |
| Molecular Formula | C19H18ClN5O4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3-nitrophenyl)-1-propylurea |
| SMILES | CCCN(Cc1nnc(-c2ccccc2Cl)o1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18ClN5O4/c1-2-10-24(19(26)21-13-6-5-7-14(11-13)25(27)28)12-17-22-23-18(29-17)15-8-3-4-9-16(15)20/h3-9,11H,2,10,12H2,1H3,(H,21,26) |
| InChIKey | MWLGAAXHAKEISW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|