C18H19N5O5 — CID 9371658
2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-nitrophenyl)acetamide (PubChem CID 9371658) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9371658 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-propylamino]-N-(2-nitrophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1[N+](=O)[O-])Cc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C18H19N5O5/c1-2-9-22(12-17-20-21-18(28-17)15-8-5-10-27-15)11-16(24)19-13-6-3-4-7-14(13)23(25)26/h3-8,10H,2,9,11-12H2,1H3,(H,19,24) |
| InChIKey | UJTXQOAQNJIOBU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|