C17H21ClN2O2 — CID 18135458
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-pentylpropanamide (PubChem CID 18135458) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-pentylpropanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 18135458 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCc1ncc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-2-3-6-11-19-16(21)9-10-17-20-12-15(22-17)13-7-4-5-8-14(13)18/h4-5,7-8,12H,2-3,6,9-11H2,1H3,(H,19,21) |
| InChIKey | XGWACUYOGNNXCA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|