C24H21ClN2O3 — CID 16599298
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-naphthalen-2-yloxyethyl)propanamide (PubChem CID 16599298) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-naphthalen-2-yloxyethyl)propanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-naphthalen-2-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 16599298 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-naphthalen-2-yloxyethyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2Cl)o1)NCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H21ClN2O3/c25-21-8-4-3-7-20(21)22-16-27-24(30-22)12-11-23(28)26-13-14-29-19-10-9-17-5-1-2-6-18(17)15-19/h1-10,15-16H,11-14H2,(H,26,28) |
| InChIKey | VFSNURNSMDSYFH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|