About 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide (PubChem CID 55497381) has the molecular formula C21H21ClN4O4
and a molecular weight of 428.88 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide.
Molecular Properties
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide |
| PubChem CID | 55497381 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)CCc2ncc(-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C21H21ClN4O4/c1-29-15-8-6-14(7-9-15)23-13-20(28)26-25-19(27)10-11-21-24-12-18(30-21)16-4-2-3-5-17(16)22/h2-9,12,23H,10-11,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | SMFUVWBOCCVNMR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide?
The IUPAC name of 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide (CID 55497381) is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide.
What is the SMILES notation for 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide?
The canonical SMILES for 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide is COc1ccc(NCC(=O)NNC(=O)CCc2ncc(-c3ccccc3Cl)o2)cc1.
What is the InChIKey of 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide?
The InChIKey is SMFUVWBOCCVNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN4O4/c1-29-15-8-6-14(7-9-15)23-13-20(28)26-25-19(27)10-11-21-24-12-18(30-21)16-4-2-3-5-17(16)22/h2-9,12,23H,10-11,13H2,1H3,(H,25,27)(H,26,28).
What are the key properties of 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide?
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide has a molecular weight of 428.88 g/mol, XLogP of 3.20, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(4-methoxyanilino)acetyl]propanehydrazide is sourced from PubChem (CID 55497381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).