C22H18ClN5O3 — CID 55494267
N'-[3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 55494267) has the molecular formula C22H18ClN5O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is N'-[3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55494267 |
| Molecular Formula | C22H18ClN5O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N'-[3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CCc1ncc(-c2ccccc2Cl)o1)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H18ClN5O3/c23-16-9-5-4-8-15(16)19-13-24-21(31-19)11-10-20(29)27-28-22(30)18-12-17(25-26-18)14-6-2-1-3-7-14/h1-9,12-13H,10-11H2,(H,25,26)(H,27,29)(H,28,30) |
| InChIKey | UONSFCCEANYRCE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|