C22H21Cl2N3O5 — CID 30039999
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide (PubChem CID 30039999) has the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 30039999 |
| Molecular Formula | C22H21Cl2N3O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)CCc1ncc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C22H21Cl2N3O5/c1-2-30-17-5-3-4-6-18(17)31-13-21(29)27-26-20(28)9-10-22-25-12-19(32-22)15-8-7-14(23)11-16(15)24/h3-8,11-12H,2,9-10,13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | OHSJNHRABUFYKI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|