C17H13Cl2N3O2 — CID 51312308
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide (PubChem CID 51312308) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 51312308 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2Cl)o1)Nc1ccccn1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c18-11-4-5-12(13(19)9-11)14-10-21-17(24-14)7-6-16(23)22-15-3-1-2-8-20-15/h1-5,8-10H,6-7H2,(H,20,22,23) |
| InChIKey | GCKPCGXRGCKXBQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |